C27H28INO6 — CID 167687756
2-[2-(furan-2-yl)ethyl]-4-methylbenzoic acid;furan-2-ylmethanamine;2-iodo-4-methylbenzoic acid (PubChem CID 167687756) has the molecular formula C27H28INO6 and a molecular weight of 589.43 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)ethyl]-4-methylbenzoic acid;furan-2-ylmethanamine;2-iodo-4-methylbenzoic acid.
| Compound Name | 2-[2-(furan-2-yl)ethyl]-4-methylbenzoic acid;furan-2-ylmethanamine;2-iodo-4-methylbenzoic acid |
|---|---|
| PubChem CID | 167687756 |
| Molecular Formula | C27H28INO6 |
| Molecular Weight | 589.43 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | 2-[2-(furan-2-yl)ethyl]-4-methylbenzoic acid;furan-2-ylmethanamine;2-iodo-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(CCc2ccco2)c1.Cc1ccc(C(=O)O)c(I)c1.NCc1ccco1 |
| InChI | InChI=1S/C14H14O3.C8H7IO2.C5H7NO/c1-10-4-7-13(14(15)16)11(9-10)5-6-12-3-2-8-17-12;1-5-2-3-6(8(10)11)7(9)4-5;6-4-5-2-1-3-7-5/h2-4,7-9H,5-6H2,1H3,(H,15,16);2-4H,1H3,(H,10,11);1-3H,4,6H2 |
| InChIKey | WLXDKZNPQHPXIN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|