C13H13Cl2N3O2S2 — CID 16768930
4-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3-thiazol-2-amine (PubChem CID 16768930) has the molecular formula C13H13Cl2N3O2S2 and a molecular weight of 378.31 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 16768930 |
| Molecular Formula | C13H13Cl2N3O2S2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C2CCCN2S(=O)(=O)c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C13H13Cl2N3O2S2/c14-9-4-3-8(6-10(9)15)22(19,20)18-5-1-2-12(18)11-7-21-13(16)17-11/h3-4,6-7,12H,1-2,5H2,(H2,16,17) |
| InChIKey | QKDLHWSMUJQOKG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |