C24H32N4O4S2 — CID 167710262
tert-butyl N-[6-oxo-6-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexyl]carbamate (PubChem CID 167710262) has the molecular formula C24H32N4O4S2 and a molecular weight of 504.68 g/mol. Its IUPAC name is tert-butyl N-[6-oxo-6-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-oxo-6-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 167710262 |
| Molecular Formula | C24H32N4O4S2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | tert-butyl N-[6-oxo-6-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexyl]carbamate |
| SMILES | C#CCCC(=O)NCCc1nc(-c2nc(C(=O)CCCCCNC(=O)OC(C)(C)C)cs2)cs1 |
| InChI | InChI=1S/C24H32N4O4S2/c1-5-6-11-20(30)25-14-12-21-27-18(16-33-21)22-28-17(15-34-22)19(29)10-8-7-9-13-26-23(31)32-24(2,3)4/h1,15-16H,6-14H2,2-4H3,(H,25,30)(H,26,31) |
| InChIKey | VTOHBTPVUZAPLT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|