C20H27N3O5S2 — CID 147558749
tert-butyl N-[[4-[4-(8-hydroxy-7-oxooctanoyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate (PubChem CID 147558749) has the molecular formula C20H27N3O5S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is tert-butyl N-[[4-[4-(8-hydroxy-7-oxooctanoyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[4-(8-hydroxy-7-oxooctanoyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 147558749 |
| Molecular Formula | C20H27N3O5S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | tert-butyl N-[[4-[4-(8-hydroxy-7-oxooctanoyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nc(-c2nc(C(=O)CCCCCC(=O)CO)cs2)cs1 |
| InChI | InChI=1S/C20H27N3O5S2/c1-20(2,3)28-19(27)21-9-17-22-15(12-29-17)18-23-14(11-30-18)16(26)8-6-4-5-7-13(25)10-24/h11-12,24H,4-10H2,1-3H3,(H,21,27) |
| InChIKey | FSFDAPKZIYBYPC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|