C28H40N4O4S2 — CID 167591933
tert-butyl N-[10-oxo-10-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]decyl]carbamate (PubChem CID 167591933) has the molecular formula C28H40N4O4S2 and a molecular weight of 560.79 g/mol. Its IUPAC name is tert-butyl N-[10-oxo-10-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]decyl]carbamate.
| Compound Name | tert-butyl N-[10-oxo-10-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]decyl]carbamate |
|---|---|
| PubChem CID | 167591933 |
| Molecular Formula | C28H40N4O4S2 |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | tert-butyl N-[10-oxo-10-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]decyl]carbamate |
| SMILES | C#CCCC(=O)NCCc1nc(-c2nc(C(=O)CCCCCCCCCNC(=O)OC(C)(C)C)cs2)cs1 |
| InChI | InChI=1S/C28H40N4O4S2/c1-5-6-15-24(34)29-18-16-25-31-22(20-37-25)26-32-21(19-38-26)23(33)14-12-10-8-7-9-11-13-17-30-27(35)36-28(2,3)4/h1,19-20H,6-18H2,2-4H3,(H,29,34)(H,30,35) |
| InChIKey | ZSPRCAMUWXVHQK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|