C19H27N5O5S2 — CID 71468930
tert-butyl N-[[4-[4-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate (PubChem CID 71468930) has the molecular formula C19H27N5O5S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is tert-butyl N-[[4-[4-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[4-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71468930 |
| Molecular Formula | C19H27N5O5S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | tert-butyl N-[[4-[4-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nc(-c2nc(C(=O)NCCCCCC(=O)NO)cs2)cs1 |
| InChI | InChI=1S/C19H27N5O5S2/c1-19(2,3)29-18(27)21-9-15-22-13(11-30-15)17-23-12(10-31-17)16(26)20-8-6-4-5-7-14(25)24-28/h10-11,28H,4-9H2,1-3H3,(H,20,26)(H,21,27)(H,24,25) |
| InChIKey | CQLJYHNTHMSMLR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|