C18H25N5O5S2 — CID 71468929
tert-butyl N-[[4-[4-[[5-(hydroxyamino)-5-oxopentyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate (PubChem CID 71468929) has the molecular formula C18H25N5O5S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is tert-butyl N-[[4-[4-[[5-(hydroxyamino)-5-oxopentyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[4-[[5-(hydroxyamino)-5-oxopentyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71468929 |
| Molecular Formula | C18H25N5O5S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | tert-butyl N-[[4-[4-[[5-(hydroxyamino)-5-oxopentyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nc(-c2nc(C(=O)NCCCCC(=O)NO)cs2)cs1 |
| InChI | InChI=1S/C18H25N5O5S2/c1-18(2,3)28-17(26)20-8-14-21-12(10-29-14)16-22-11(9-30-16)15(25)19-7-5-4-6-13(24)23-27/h9-10,27H,4-8H2,1-3H3,(H,19,25)(H,20,26)(H,23,24) |
| InChIKey | UUQZCEFAHCAZKO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|