C18H23N3O4S2 — CID 167531735
4-[2-[4-(4-hexanoyl-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]ethylamino]-4-oxobutanoic acid (PubChem CID 167531735) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-[2-[4-(4-hexanoyl-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[4-(4-hexanoyl-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 167531735 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-[2-[4-(4-hexanoyl-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]ethylamino]-4-oxobutanoic acid |
| SMILES | CCCCCC(=O)c1csc(-c2csc(CCNC(=O)CCC(=O)O)n2)n1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-2-3-4-5-14(22)12-10-27-18(21-12)13-11-26-16(20-13)8-9-19-15(23)6-7-17(24)25/h10-11H,2-9H2,1H3,(H,19,23)(H,24,25) |
| InChIKey | BGYTYWLZPPJOQQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|