C21H29N3O4S2 — CID 159538294
tert-butyl N-[[4-[4-(8-oxononanoyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate (PubChem CID 159538294) has the molecular formula C21H29N3O4S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is tert-butyl N-[[4-[4-(8-oxononanoyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[4-(8-oxononanoyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 159538294 |
| Molecular Formula | C21H29N3O4S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | tert-butyl N-[[4-[4-(8-oxononanoyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
| SMILES | CC(=O)CCCCCCC(=O)c1csc(-c2csc(CNC(=O)OC(C)(C)C)n2)n1 |
| InChI | InChI=1S/C21H29N3O4S2/c1-14(25)9-7-5-6-8-10-17(26)15-12-30-19(24-15)16-13-29-18(23-16)11-22-20(27)28-21(2,3)4/h12-13H,5-11H2,1-4H3,(H,22,27) |
| InChIKey | FBZJVWOVGBKUFV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|