C20H21N5S2 — CID 167713866
1-[(E)-1-[4-methyl-2-(3-methylanilino)-1,3-thiazol-5-yl]ethylideneamino]-3-phenylthiourea (PubChem CID 167713866) has the molecular formula C20H21N5S2 and a molecular weight of 395.56 g/mol. Its IUPAC name is 1-[(E)-1-[4-methyl-2-(3-methylanilino)-1,3-thiazol-5-yl]ethylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-1-[4-methyl-2-(3-methylanilino)-1,3-thiazol-5-yl]ethylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 167713866 |
| Molecular Formula | C20H21N5S2 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[(E)-1-[4-methyl-2-(3-methylanilino)-1,3-thiazol-5-yl]ethylideneamino]-3-phenylthiourea |
| SMILES | C/C(=N\NC(=S)Nc1ccccc1)c1sc(Nc2cccc(C)c2)nc1C |
| InChI | InChI=1S/C20H21N5S2/c1-13-8-7-11-17(12-13)23-20-21-14(2)18(27-20)15(3)24-25-19(26)22-16-9-5-4-6-10-16/h4-12H,1-3H3,(H,21,23)(H2,22,25,26)/b24-15+ |
| InChIKey | IJESTYOWGSRRRM-BUVRLJJBSA-N |
| XLogP | 5.21 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|