C7H13ClN2O — CID 167716973
3,6-diazabicyclo[3.2.2]nonan-7-one;hydrochloride (PubChem CID 167716973) has the molecular formula C7H13ClN2O and a molecular weight of 176.65 g/mol. Its IUPAC name is 3,6-diazabicyclo[3.2.2]nonan-7-one;hydrochloride.
| Compound Name | 3,6-diazabicyclo[3.2.2]nonan-7-one;hydrochloride |
|---|---|
| PubChem CID | 167716973 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3,6-diazabicyclo[3.2.2]nonan-7-one;hydrochloride |
| SMILES | Cl.O=C1NC2CCC1CNC2 |
| InChI | InChI=1S/C7H12N2O.ClH/c10-7-5-1-2-6(9-7)4-8-3-5;/h5-6,8H,1-4H2,(H,9,10);1H |
| InChIKey | MOTRDRWEVWRAIE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |