C11H8ClNO3 — CID 167729681
2-acetamido-5-chloro-3-ethynylbenzoic acid (PubChem CID 167729681) has the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. Its IUPAC name is 2-acetamido-5-chloro-3-ethynylbenzoic acid.
| Compound Name | 2-acetamido-5-chloro-3-ethynylbenzoic acid |
|---|---|
| PubChem CID | 167729681 |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-acetamido-5-chloro-3-ethynylbenzoic acid |
| SMILES | C#Cc1cc(Cl)cc(C(=O)O)c1NC(C)=O |
| InChI | InChI=1S/C11H8ClNO3/c1-3-7-4-8(12)5-9(11(15)16)10(7)13-6(2)14/h1,4-5H,2H3,(H,13,14)(H,15,16) |
| InChIKey | LHFZYNURGUALTA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|