C19H13ClO4 — CID 71534440
5-chloro-2-[2-(2-ethynyl-4,5-dimethoxyphenyl)ethynyl]benzoic acid (PubChem CID 71534440) has the molecular formula C19H13ClO4 and a molecular weight of 340.76 g/mol. Its IUPAC name is 5-chloro-2-[2-(2-ethynyl-4,5-dimethoxyphenyl)ethynyl]benzoic acid.
| Compound Name | 5-chloro-2-[2-(2-ethynyl-4,5-dimethoxyphenyl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 71534440 |
| Molecular Formula | C19H13ClO4 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 5-chloro-2-[2-(2-ethynyl-4,5-dimethoxyphenyl)ethynyl]benzoic acid |
| SMILES | C#Cc1cc(OC)c(OC)cc1C#Cc1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C19H13ClO4/c1-4-12-9-17(23-2)18(24-3)10-14(12)6-5-13-7-8-15(20)11-16(13)19(21)22/h1,7-11H,2-3H3,(H,21,22) |
| InChIKey | RMATVYDRVDECSX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|