C11H12F3NO4 — CID 167731106
(1S,3S,5S,6S)-2-prop-2-enoxycarbonyl-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (PubChem CID 167731106) has the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. Its IUPAC name is (1S,3S,5S,6S)-2-prop-2-enoxycarbonyl-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid.
| Compound Name | (1S,3S,5S,6S)-2-prop-2-enoxycarbonyl-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
|---|---|
| PubChem CID | 167731106 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (1S,3S,5S,6S)-2-prop-2-enoxycarbonyl-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| SMILES | C=CCOC(=O)N1[C@H]2[C@@H](C[C@H]1C(=O)O)[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO4/c1-2-3-19-10(18)15-6(9(16)17)4-5-7(8(5)15)11(12,13)14/h2,5-8H,1,3-4H2,(H,16,17)/t5-,6-,7-,8-/m0/s1 |
| InChIKey | BKEFVDGPHYHVHP-XAMCCFCMSA-N |
| XLogP | 1.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|