About [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine
[(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine (PubChem CID 167732628) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine.
Analyze [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine?
The IUPAC name of [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine (CID 167732628) is [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine.
What is the SMILES notation for [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine?
The canonical SMILES for [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine is NCC1C[C@@H]2C[C@H](C1)N2.
What is the InChIKey of [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine?
The InChIKey is CWKXFJMKITVIGU-DGUCWDHESA-N. The full InChI is InChI=1S/C7H14N2/c8-4-5-1-6-3-7(2-5)9-6/h5-7,9H,1-4,8H2/t5?,6-,7+.
What are the key properties of [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine?
[(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine has a molecular weight of 126.20 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-6-azabicyclo[3.1.1]heptan-3-yl]methanamine is sourced from PubChem (CID 167732628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).