C15H23NO6 — CID 167739754
4-(4-hydroxy-1-prop-2-enoxycarbonylpiperidin-4-yl)oxane-4-carboxylic acid (PubChem CID 167739754) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-(4-hydroxy-1-prop-2-enoxycarbonylpiperidin-4-yl)oxane-4-carboxylic acid.
| Compound Name | 4-(4-hydroxy-1-prop-2-enoxycarbonylpiperidin-4-yl)oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 167739754 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-(4-hydroxy-1-prop-2-enoxycarbonylpiperidin-4-yl)oxane-4-carboxylic acid |
| SMILES | C=CCOC(=O)N1CCC(O)(C2(C(=O)O)CCOCC2)CC1 |
| InChI | InChI=1S/C15H23NO6/c1-2-9-22-13(19)16-7-3-15(20,4-8-16)14(12(17)18)5-10-21-11-6-14/h2,20H,1,3-11H2,(H,17,18) |
| InChIKey | LAVJFJNLCTVUBK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|