C11H17NO5 — CID 163217035
prop-2-enyl 7-hydroxy-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 163217035) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is prop-2-enyl 7-hydroxy-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | prop-2-enyl 7-hydroxy-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 163217035 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | prop-2-enyl 7-hydroxy-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | C=CCOC(=O)N1CCC2(CC1O)OCCO2 |
| InChI | InChI=1S/C11H17NO5/c1-2-5-15-10(14)12-4-3-11(8-9(12)13)16-6-7-17-11/h2,9,13H,1,3-8H2 |
| InChIKey | GFBCVEKMBCAUQE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|