C14H21NO4 — CID 164787980
prop-2-enyl (1S,6S,8S)-5-methoxy-11-oxa-4-azatricyclo[6.2.1.01,6]undecane-4-carboxylate (PubChem CID 164787980) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is prop-2-enyl (1S,6S,8S)-5-methoxy-11-oxa-4-azatricyclo[6.2.1.01,6]undecane-4-carboxylate.
| Compound Name | prop-2-enyl (1S,6S,8S)-5-methoxy-11-oxa-4-azatricyclo[6.2.1.01,6]undecane-4-carboxylate |
|---|---|
| PubChem CID | 164787980 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | prop-2-enyl (1S,6S,8S)-5-methoxy-11-oxa-4-azatricyclo[6.2.1.01,6]undecane-4-carboxylate |
| SMILES | C=CCOC(=O)N1CC[C@@]23CC[C@@H](C[C@@H]2C1OC)O3 |
| InChI | InChI=1S/C14H21NO4/c1-3-8-18-13(16)15-7-6-14-5-4-10(19-14)9-11(14)12(15)17-2/h3,10-12H,1,4-9H2,2H3/t10-,11+,12?,14-/m0/s1 |
| InChIKey | RNKIOCGXYAHRER-BRZZBQFESA-N |
| XLogP | 1.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|