C26H35ClN2O8 — CID 165017465
(1S,6S,8S)-11-oxa-4-azatricyclo[6.2.1.01,6]undecan-5-one;prop-2-enyl carbonochloridate;prop-2-enyl (1S,6S,8S)-5-oxo-11-oxa-4-azatricyclo[6.2.1.01,6]undecane-4-carboxylate (PubChem CID 165017465) has the molecular formula C26H35ClN2O8 and a molecular weight of 539.03 g/mol. Its IUPAC name is (1S,6S,8S)-11-oxa-4-azatricyclo[6.2.1.01,6]undecan-5-one;prop-2-enyl carbonochloridate;prop-2-enyl (1S,6S,8S)-5-oxo-11-oxa-4-azatricyclo[6.2.1.01,6]undecane-4-carboxylate.
| Compound Name | (1S,6S,8S)-11-oxa-4-azatricyclo[6.2.1.01,6]undecan-5-one;prop-2-enyl carbonochloridate;prop-2-enyl (1S,6S,8S)-5-oxo-11-oxa-4-azatricyclo[6.2.1.01,6]undecane-4-carboxylate |
|---|---|
| PubChem CID | 165017465 |
| Molecular Formula | C26H35ClN2O8 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (1S,6S,8S)-11-oxa-4-azatricyclo[6.2.1.01,6]undecan-5-one;prop-2-enyl carbonochloridate;prop-2-enyl (1S,6S,8S)-5-oxo-11-oxa-4-azatricyclo[6.2.1.01,6]undecane-4-carboxylate |
| SMILES | C=CCOC(=O)Cl.C=CCOC(=O)N1CC[C@@]23CC[C@@H](C[C@@H]2C1=O)O3.O=C1NCC[C@@]23CC[C@@H](C[C@H]12)O3 |
| InChI | InChI=1S/C13H17NO4.C9H13NO2.C4H5ClO2/c1-2-7-17-12(16)14-6-5-13-4-3-9(18-13)8-10(13)11(14)15;11-8-7-5-6-1-2-9(7,12-6)3-4-10-8;1-2-3-7-4(5)6/h2,9-10H,1,3-8H2;6-7H,1-5H2,(H,10,11);2H,1,3H2/t9-,10+,13-;6-,7+,9-;/m00./s1 |
| InChIKey | KQKZCKTZBFMFJB-LPSFSIJYSA-N |
| XLogP | 3.47 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|