C10H12N4O3 — CID 167740929
tert-butyl N-(5-cyano-6-oxo-1H-pyridazin-3-yl)carbamate (PubChem CID 167740929) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is tert-butyl N-(5-cyano-6-oxo-1H-pyridazin-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-cyano-6-oxo-1H-pyridazin-3-yl)carbamate |
|---|---|
| PubChem CID | 167740929 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | tert-butyl N-(5-cyano-6-oxo-1H-pyridazin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C#N)c(=O)[nH]n1 |
| InChI | InChI=1S/C10H12N4O3/c1-10(2,3)17-9(16)12-7-4-6(5-11)8(15)14-13-7/h4H,1-3H3,(H,14,15)(H,12,13,16) |
| InChIKey | KXWCJEHVMBZSBR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |