C11H15F2N3 — CID 167745064
1-(2,2-difluoro-2-phenylethyl)-2,3-dimethylguanidine (PubChem CID 167745064) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-(2,2-difluoro-2-phenylethyl)-2,3-dimethylguanidine.
| Compound Name | 1-(2,2-difluoro-2-phenylethyl)-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 167745064 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-(2,2-difluoro-2-phenylethyl)-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C11H15F2N3/c1-14-10(15-2)16-8-11(12,13)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H2,14,15,16) |
| InChIKey | KJRHHVCVLYEDTG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|