C19H20F2N2O3S — CID 167750645
N-[3-[[2-(3,4-difluorophenyl)acetyl]amino]propyl]-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 167750645) has the molecular formula C19H20F2N2O3S and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[3-[[2-(3,4-difluorophenyl)acetyl]amino]propyl]-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-[3-[[2-(3,4-difluorophenyl)acetyl]amino]propyl]-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 167750645 |
| Molecular Formula | C19H20F2N2O3S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[3-[[2-(3,4-difluorophenyl)acetyl]amino]propyl]-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccs1)NCCCNC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H20F2N2O3S/c20-14-5-4-13(11-15(14)21)12-19(26)23-9-2-8-22-18(25)7-6-16(24)17-3-1-10-27-17/h1,3-5,10-11H,2,6-9,12H2,(H,22,25)(H,23,26) |
| InChIKey | QSXDCRLZBBTILP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|