C13H18F2N4O2 — CID 167752658
(1S,3S,6R)-7,7-difluoro-N-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propyl]bicyclo[4.1.0]heptane-3-carboxamide (PubChem CID 167752658) has the molecular formula C13H18F2N4O2 and a molecular weight of 300.31 g/mol. Its IUPAC name is (1S,3S,6R)-7,7-difluoro-N-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propyl]bicyclo[4.1.0]heptane-3-carboxamide.
| Compound Name | (1S,3S,6R)-7,7-difluoro-N-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propyl]bicyclo[4.1.0]heptane-3-carboxamide |
|---|---|
| PubChem CID | 167752658 |
| Molecular Formula | C13H18F2N4O2 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (1S,3S,6R)-7,7-difluoro-N-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propyl]bicyclo[4.1.0]heptane-3-carboxamide |
| SMILES | O=C(NCCCc1n[nH]c(=O)[nH]1)[C@H]1CC[C@@H]2[C@H](C1)C2(F)F |
| InChI | InChI=1S/C13H18F2N4O2/c14-13(15)8-4-3-7(6-9(8)13)11(20)16-5-1-2-10-17-12(21)19-18-10/h7-9H,1-6H2,(H,16,20)(H2,17,18,19,21)/t7-,8+,9-/m0/s1 |
| InChIKey | FWEMUYCQGPQUOM-YIZRAAEISA-N |
| XLogP | 0.83 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|