C9H14N4O2S2 — CID 154835112
N-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propyl]-1,3-dithiolane-2-carboxamide (PubChem CID 154835112) has the molecular formula C9H14N4O2S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propyl]-1,3-dithiolane-2-carboxamide.
| Compound Name | N-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propyl]-1,3-dithiolane-2-carboxamide |
|---|---|
| PubChem CID | 154835112 |
| Molecular Formula | C9H14N4O2S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | N-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propyl]-1,3-dithiolane-2-carboxamide |
| SMILES | O=C(NCCCc1n[nH]c(=O)[nH]1)C1SCCS1 |
| InChI | InChI=1S/C9H14N4O2S2/c14-7(8-16-4-5-17-8)10-3-1-2-6-11-9(15)13-12-6/h8H,1-5H2,(H,10,14)(H2,11,12,13,15) |
| InChIKey | SBJOUQBHECDJCY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|