C12H20N4O3 — CID 137025359
N-(3-cyclopentyloxypropyl)-2-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)acetamide (PubChem CID 137025359) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-2-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)acetamide.
| Compound Name | N-(3-cyclopentyloxypropyl)-2-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 137025359 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-2-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)[nH]1)NCCCOC1CCCC1 |
| InChI | InChI=1S/C12H20N4O3/c17-11(8-10-14-12(18)16-15-10)13-6-3-7-19-9-4-1-2-5-9/h9H,1-8H2,(H,13,17)(H2,14,15,16,18) |
| InChIKey | LUBBTSALEKMRJT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|