C19H15FN4O2 — CID 167757516
N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-oxo-1H-quinoxaline-6-carboxamide (PubChem CID 167757516) has the molecular formula C19H15FN4O2 and a molecular weight of 350.35 g/mol. Its IUPAC name is N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-oxo-1H-quinoxaline-6-carboxamide.
| Compound Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-oxo-1H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 167757516 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-oxo-1H-quinoxaline-6-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2cc(F)ccc12)c1ccc2[nH]c(=O)cnc2c1 |
| InChI | InChI=1S/C19H15FN4O2/c20-13-2-3-14-12(9-22-16(14)8-13)5-6-21-19(26)11-1-4-15-17(7-11)23-10-18(25)24-15/h1-4,7-10,22H,5-6H2,(H,21,26)(H,24,25) |
| InChIKey | IBIBGSLQQAABHW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |