C11H22N4O2S — CID 167763013
1-[2-(diethylamino)ethyl]-N,N-dimethylpyrazole-4-sulfonamide (PubChem CID 167763013) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-N,N-dimethylpyrazole-4-sulfonamide.
| Compound Name | 1-[2-(diethylamino)ethyl]-N,N-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 167763013 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-N,N-dimethylpyrazole-4-sulfonamide |
| SMILES | CCN(CC)CCn1cc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C11H22N4O2S/c1-5-14(6-2)7-8-15-10-11(9-12-15)18(16,17)13(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | TWMJIUBKCLEQKV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |