C13H27N5O2S — CID 102998589
N-[3-(dimethylamino)propyl]-N-ethyl-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide (PubChem CID 102998589) has the molecular formula C13H27N5O2S and a molecular weight of 317.46 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-ethyl-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-ethyl-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 102998589 |
| Molecular Formula | C13H27N5O2S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-ethyl-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
| SMILES | CCN(CCCN(C)C)S(=O)(=O)c1cnn(CCNC)c1 |
| InChI | InChI=1S/C13H27N5O2S/c1-5-18(9-6-8-16(3)4)21(19,20)13-11-15-17(12-13)10-7-14-2/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | IXOSWRGGJVBZMW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |