C12H24N4O2S2 — CID 115988388
1-[3-(ethylamino)propyl]-N-methyl-N-(2-methylsulfanylethyl)pyrazole-4-sulfonamide (PubChem CID 115988388) has the molecular formula C12H24N4O2S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[3-(ethylamino)propyl]-N-methyl-N-(2-methylsulfanylethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-[3-(ethylamino)propyl]-N-methyl-N-(2-methylsulfanylethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115988388 |
| Molecular Formula | C12H24N4O2S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[3-(ethylamino)propyl]-N-methyl-N-(2-methylsulfanylethyl)pyrazole-4-sulfonamide |
| SMILES | CCNCCCn1cc(S(=O)(=O)N(C)CCSC)cn1 |
| InChI | InChI=1S/C12H24N4O2S2/c1-4-13-6-5-7-16-11-12(10-14-16)20(17,18)15(2)8-9-19-3/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | PLEJLJDFQCTGCI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|