C12H22N4O3S — CID 82744842
1-[2-(ethylamino)ethyl]-N-methyl-N-(oxolan-3-yl)pyrazole-4-sulfonamide (PubChem CID 82744842) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[2-(ethylamino)ethyl]-N-methyl-N-(oxolan-3-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-[2-(ethylamino)ethyl]-N-methyl-N-(oxolan-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 82744842 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[2-(ethylamino)ethyl]-N-methyl-N-(oxolan-3-yl)pyrazole-4-sulfonamide |
| SMILES | CCNCCn1cc(S(=O)(=O)N(C)C2CCOC2)cn1 |
| InChI | InChI=1S/C12H22N4O3S/c1-3-13-5-6-16-9-12(8-14-16)20(17,18)15(2)11-4-7-19-10-11/h8-9,11,13H,3-7,10H2,1-2H3 |
| InChIKey | JQTXRGUKFJOEHS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|