C10H20N4O4S2 — CID 79864992
N-methyl-1-[2-(methylamino)ethyl]-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide (PubChem CID 79864992) has the molecular formula C10H20N4O4S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-methyl-1-[2-(methylamino)ethyl]-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide.
| Compound Name | N-methyl-1-[2-(methylamino)ethyl]-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 79864992 |
| Molecular Formula | C10H20N4O4S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-methyl-1-[2-(methylamino)ethyl]-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide |
| SMILES | CNCCn1cc(S(=O)(=O)N(C)CCS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C10H20N4O4S2/c1-11-4-5-14-9-10(8-12-14)20(17,18)13(2)6-7-19(3,15)16/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | WXNAXQJURHSUSB-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |