C18H20N6OS — CID 167764861
1-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(1,3-benzothiazol-2-yl)triazol-1-yl]ethanone (PubChem CID 167764861) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(1,3-benzothiazol-2-yl)triazol-1-yl]ethanone.
| Compound Name | 1-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(1,3-benzothiazol-2-yl)triazol-1-yl]ethanone |
|---|---|
| PubChem CID | 167764861 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(1,3-benzothiazol-2-yl)triazol-1-yl]ethanone |
| SMILES | CN1C[C@@H]2CN(C(=O)Cn3cc(-c4nc5ccccc5s4)nn3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H20N6OS/c1-22-6-12-8-23(9-13(12)7-22)17(25)11-24-10-15(20-21-24)18-19-14-4-2-3-5-16(14)26-18/h2-5,10,12-13H,6-9,11H2,1H3/t12-,13+ |
| InChIKey | ISUBHPICEWQVOI-BETUJISGSA-N |
| XLogP | 1.57 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |