C18H22N4O4 — CID 167772602
N-(5-acetamido-2-methoxyphenyl)-2-[2-[cyclopropyl(hydroxy)methyl]imidazol-1-yl]acetamide (PubChem CID 167772602) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-2-[2-[cyclopropyl(hydroxy)methyl]imidazol-1-yl]acetamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-2-[2-[cyclopropyl(hydroxy)methyl]imidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 167772602 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-2-[2-[cyclopropyl(hydroxy)methyl]imidazol-1-yl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)Cn1ccnc1C(O)C1CC1 |
| InChI | InChI=1S/C18H22N4O4/c1-11(23)20-13-5-6-15(26-2)14(9-13)21-16(24)10-22-8-7-19-18(22)17(25)12-3-4-12/h5-9,12,17,25H,3-4,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | IETMBRRGJDVZIU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |