C14H18F3N3O2S — CID 167776517
1-[(6-methoxy-3-pyridinyl)methyl]-3-[4-(trifluoromethyl)thian-4-yl]urea (PubChem CID 167776517) has the molecular formula C14H18F3N3O2S and a molecular weight of 349.38 g/mol. Its IUPAC name is 1-[(6-methoxy-3-pyridinyl)methyl]-3-[4-(trifluoromethyl)thian-4-yl]urea.
| Compound Name | 1-[(6-methoxy-3-pyridinyl)methyl]-3-[4-(trifluoromethyl)thian-4-yl]urea |
|---|---|
| PubChem CID | 167776517 |
| Molecular Formula | C14H18F3N3O2S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-[(6-methoxy-3-pyridinyl)methyl]-3-[4-(trifluoromethyl)thian-4-yl]urea |
| SMILES | COc1ccc(CNC(=O)NC2(C(F)(F)F)CCSCC2)cn1 |
| InChI | InChI=1S/C14H18F3N3O2S/c1-22-11-3-2-10(8-18-11)9-19-12(21)20-13(14(15,16)17)4-6-23-7-5-13/h2-3,8H,4-7,9H2,1H3,(H2,19,20,21) |
| InChIKey | AVUDVSXDFGQADH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |