C19H22F2N4O2 — CID 167779887
[3-(difluoromethoxy)phenyl]-[4-(6-propan-2-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 167779887) has the molecular formula C19H22F2N4O2 and a molecular weight of 376.41 g/mol. Its IUPAC name is [3-(difluoromethoxy)phenyl]-[4-(6-propan-2-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | [3-(difluoromethoxy)phenyl]-[4-(6-propan-2-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 167779887 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [3-(difluoromethoxy)phenyl]-[4-(6-propan-2-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | CC(C)c1ccc(N2CCN(C(=O)c3cccc(OC(F)F)c3)CC2)nn1 |
| InChI | InChI=1S/C19H22F2N4O2/c1-13(2)16-6-7-17(23-22-16)24-8-10-25(11-9-24)18(26)14-4-3-5-15(12-14)27-19(20)21/h3-7,12-13,19H,8-11H2,1-2H3 |
| InChIKey | OEMGSQXTKWAPNU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |