C14H22N2O3 — CID 167787279
(2R)-2-methoxy-N-[4-(prop-2-enoylamino)-1-bicyclo[2.2.1]heptanyl]propanamide (PubChem CID 167787279) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2R)-2-methoxy-N-[4-(prop-2-enoylamino)-1-bicyclo[2.2.1]heptanyl]propanamide.
| Compound Name | (2R)-2-methoxy-N-[4-(prop-2-enoylamino)-1-bicyclo[2.2.1]heptanyl]propanamide |
|---|---|
| PubChem CID | 167787279 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2R)-2-methoxy-N-[4-(prop-2-enoylamino)-1-bicyclo[2.2.1]heptanyl]propanamide |
| SMILES | C=CC(=O)NC12CCC(NC(=O)[C@@H](C)OC)(CC1)C2 |
| InChI | InChI=1S/C14H22N2O3/c1-4-11(17)15-13-5-7-14(9-13,8-6-13)16-12(18)10(2)19-3/h4,10H,1,5-9H2,2-3H3,(H,15,17)(H,16,18)/t10-,13?,14?/m1/s1 |
| InChIKey | DTIDGOZLLILMBE-GWMXKSKGSA-N |
| XLogP | 0.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|