C16H25NO — CID 15313643
N-(3-propan-2-yl-1-adamantyl)prop-2-enamide (PubChem CID 15313643) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is N-(3-propan-2-yl-1-adamantyl)prop-2-enamide.
| Compound Name | N-(3-propan-2-yl-1-adamantyl)prop-2-enamide |
|---|---|
| PubChem CID | 15313643 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-(3-propan-2-yl-1-adamantyl)prop-2-enamide |
| SMILES | C=CC(=O)NC12CC3CC(C1)CC(C(C)C)(C3)C2 |
| InChI | InChI=1S/C16H25NO/c1-4-14(18)17-16-8-12-5-13(9-16)7-15(6-12,10-16)11(2)3/h4,11-13H,1,5-10H2,2-3H3,(H,17,18) |
| InChIKey | OVQKIKWBDOALPP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|