C23H32N4O — CID 167790130
6-(tert-butylamino)-N-(2-pyridin-2-yl-1,3-dihydroisoindol-4-yl)hexanamide (PubChem CID 167790130) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 6-(tert-butylamino)-N-(2-pyridin-2-yl-1,3-dihydroisoindol-4-yl)hexanamide.
| Compound Name | 6-(tert-butylamino)-N-(2-pyridin-2-yl-1,3-dihydroisoindol-4-yl)hexanamide |
|---|---|
| PubChem CID | 167790130 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 6-(tert-butylamino)-N-(2-pyridin-2-yl-1,3-dihydroisoindol-4-yl)hexanamide |
| SMILES | CC(C)(C)NCCCCCC(=O)Nc1cccc2c1CN(c1ccccn1)C2 |
| InChI | InChI=1S/C23H32N4O/c1-23(2,3)25-15-7-4-5-13-22(28)26-20-11-9-10-18-16-27(17-19(18)20)21-12-6-8-14-24-21/h6,8-12,14,25H,4-5,7,13,15-17H2,1-3H3,(H,26,28) |
| InChIKey | PYKBHUAIXDIYPQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|