C16H20N2O2 — CID 167790546
4-[[buta-2,3-dienoyl(ethyl)amino]methyl]-N,N-dimethylbenzamide (PubChem CID 167790546) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[[buta-2,3-dienoyl(ethyl)amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[buta-2,3-dienoyl(ethyl)amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 167790546 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-[[buta-2,3-dienoyl(ethyl)amino]methyl]-N,N-dimethylbenzamide |
| SMILES | C=C=CC(=O)N(CC)Cc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-5-7-15(19)18(6-2)12-13-8-10-14(11-9-13)16(20)17(3)4/h7-11H,1,6,12H2,2-4H3 |
| InChIKey | CGZGSFFXNBUIEY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|