C21H18ClN5O3 — CID 167791048
2-[4-[(E)-2-(6-methoxy-4-oxochromen-3-yl)ethenyl]quinazolin-2-yl]guanidine;hydrochloride (PubChem CID 167791048) has the molecular formula C21H18ClN5O3 and a molecular weight of 423.86 g/mol. Its IUPAC name is 2-[4-[(E)-2-(6-methoxy-4-oxochromen-3-yl)ethenyl]quinazolin-2-yl]guanidine;hydrochloride.
| Compound Name | 2-[4-[(E)-2-(6-methoxy-4-oxochromen-3-yl)ethenyl]quinazolin-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 167791048 |
| Molecular Formula | C21H18ClN5O3 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[4-[(E)-2-(6-methoxy-4-oxochromen-3-yl)ethenyl]quinazolin-2-yl]guanidine;hydrochloride |
| SMILES | COc1ccc2occ(/C=C/c3nc(N=C(N)N)nc4ccccc34)c(=O)c2c1.Cl |
| InChI | InChI=1S/C21H17N5O3.ClH/c1-28-13-7-9-18-15(10-13)19(27)12(11-29-18)6-8-17-14-4-2-3-5-16(14)24-21(25-17)26-20(22)23;/h2-11H,1H3,(H4,22,23,24,25,26);1H/b8-6+; |
| InChIKey | JYKWALIBUMJFER-WVLIHFOGSA-N |
| XLogP | 3.24 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|