C14H13F3N4O — CID 167793305
N-(2-azabicyclo[3.1.0]hexan-4-yl)-5-(trifluoromethyl)-1H-indazole-3-carboxamide (PubChem CID 167793305) has the molecular formula C14H13F3N4O and a molecular weight of 310.28 g/mol. Its IUPAC name is N-(2-azabicyclo[3.1.0]hexan-4-yl)-5-(trifluoromethyl)-1H-indazole-3-carboxamide.
| Compound Name | N-(2-azabicyclo[3.1.0]hexan-4-yl)-5-(trifluoromethyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 167793305 |
| Molecular Formula | C14H13F3N4O |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(2-azabicyclo[3.1.0]hexan-4-yl)-5-(trifluoromethyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(NC1CNC2CC21)c1n[nH]c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C14H13F3N4O/c15-14(16,17)6-1-2-9-8(3-6)12(21-20-9)13(22)19-11-5-18-10-4-7(10)11/h1-3,7,10-11,18H,4-5H2,(H,19,22)(H,20,21) |
| InChIKey | IEVDCJSBMBIASP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |