C11H10F4N4O — CID 106289149
5-amino-N-(2,2,3,3-tetrafluoropropyl)-1H-indazole-3-carboxamide (PubChem CID 106289149) has the molecular formula C11H10F4N4O and a molecular weight of 290.22 g/mol. Its IUPAC name is 5-amino-N-(2,2,3,3-tetrafluoropropyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-amino-N-(2,2,3,3-tetrafluoropropyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 106289149 |
| Molecular Formula | C11H10F4N4O |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 5-amino-N-(2,2,3,3-tetrafluoropropyl)-1H-indazole-3-carboxamide |
| SMILES | Nc1ccc2[nH]nc(C(=O)NCC(F)(F)C(F)F)c2c1 |
| InChI | InChI=1S/C11H10F4N4O/c12-10(13)11(14,15)4-17-9(20)8-6-3-5(16)1-2-7(6)18-19-8/h1-3,10H,4,16H2,(H,17,20)(H,18,19) |
| InChIKey | YOJYEIMOOVOKQM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|