C11H12F2N4O2 — CID 106164289
5-amino-N-(2,2-difluoro-3-hydroxypropyl)-1H-indazole-3-carboxamide (PubChem CID 106164289) has the molecular formula C11H12F2N4O2 and a molecular weight of 270.24 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 106164289 |
| Molecular Formula | C11H12F2N4O2 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-1H-indazole-3-carboxamide |
| SMILES | Nc1ccc2[nH]nc(C(=O)NCC(F)(F)CO)c2c1 |
| InChI | InChI=1S/C11H12F2N4O2/c12-11(13,5-18)4-15-10(19)9-7-3-6(14)1-2-8(7)16-17-9/h1-3,18H,4-5,14H2,(H,15,19)(H,16,17) |
| InChIKey | QPTSZKYITOMQCS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|