C12H16N4O3 — CID 55083677
5-amino-N-[2-(2-hydroxyethoxy)ethyl]-1H-indazole-3-carboxamide (PubChem CID 55083677) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-amino-N-[2-(2-hydroxyethoxy)ethyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-amino-N-[2-(2-hydroxyethoxy)ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 55083677 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5-amino-N-[2-(2-hydroxyethoxy)ethyl]-1H-indazole-3-carboxamide |
| SMILES | Nc1ccc2[nH]nc(C(=O)NCCOCCO)c2c1 |
| InChI | InChI=1S/C12H16N4O3/c13-8-1-2-10-9(7-8)11(16-15-10)12(18)14-3-5-19-6-4-17/h1-2,7,17H,3-6,13H2,(H,14,18)(H,15,16) |
| InChIKey | PONBAZFTQAJFDN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|