C18H19ClN4O — CID 67545057
N-[2-(4-amino-2-chlorophenyl)-2-methylpropyl]-1H-indazole-3-carboxamide (PubChem CID 67545057) has the molecular formula C18H19ClN4O and a molecular weight of 342.83 g/mol. Its IUPAC name is N-[2-(4-amino-2-chlorophenyl)-2-methylpropyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[2-(4-amino-2-chlorophenyl)-2-methylpropyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 67545057 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[2-(4-amino-2-chlorophenyl)-2-methylpropyl]-1H-indazole-3-carboxamide |
| SMILES | CC(C)(CNC(=O)c1n[nH]c2ccccc12)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C18H19ClN4O/c1-18(2,13-8-7-11(20)9-14(13)19)10-21-17(24)16-12-5-3-4-6-15(12)22-23-16/h3-9H,10,20H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | QIJYBYFCTHCXEE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|