C16H13N5S — CID 167801055
4-imidazo[1,2-a]pyridin-2-yl-N-(thiadiazol-4-ylmethyl)aniline (PubChem CID 167801055) has the molecular formula C16H13N5S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyridin-2-yl-N-(thiadiazol-4-ylmethyl)aniline.
| Compound Name | 4-imidazo[1,2-a]pyridin-2-yl-N-(thiadiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 167801055 |
| Molecular Formula | C16H13N5S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-imidazo[1,2-a]pyridin-2-yl-N-(thiadiazol-4-ylmethyl)aniline |
| SMILES | c1ccn2cc(-c3ccc(NCc4csnn4)cc3)nc2c1 |
| InChI | InChI=1S/C16H13N5S/c1-2-8-21-10-15(18-16(21)3-1)12-4-6-13(7-5-12)17-9-14-11-22-20-19-14/h1-8,10-11,17H,9H2 |
| InChIKey | HMGQORGSXISFQG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |