C21H16ClN5O3S — CID 167815789
N-[5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 167815789) has the molecular formula C21H16ClN5O3S and a molecular weight of 453.91 g/mol. Its IUPAC name is N-[5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-[5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 167815789 |
| Molecular Formula | C21H16ClN5O3S |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Nc3cc(Cl)ccc3Sc3nncn3C)cc2C1=O |
| InChI | InChI=1S/C21H16ClN5O3S/c1-3-8-27-19(29)14-6-4-12(9-15(14)20(27)30)18(28)24-16-10-13(22)5-7-17(16)31-21-25-23-11-26(21)2/h3-7,9-11H,1,8H2,2H3,(H,24,28) |
| InChIKey | UGRRKBZWRFNFLJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|