C21H18N6O2 — CID 167817105
N-(6-cyano-5-methyl-1H-indazol-3-yl)-1-(2-methoxyphenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 167817105) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-(6-cyano-5-methyl-1H-indazol-3-yl)-1-(2-methoxyphenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-(6-cyano-5-methyl-1H-indazol-3-yl)-1-(2-methoxyphenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167817105 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(6-cyano-5-methyl-1H-indazol-3-yl)-1-(2-methoxyphenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | COc1ccccc1-n1ncc(C(=O)Nc2n[nH]c3cc(C#N)c(C)cc23)c1C |
| InChI | InChI=1S/C21H18N6O2/c1-12-8-15-17(9-14(12)10-22)25-26-20(15)24-21(28)16-11-23-27(13(16)2)18-6-4-5-7-19(18)29-3/h4-9,11H,1-3H3,(H2,24,25,26,28) |
| InChIKey | XBYQJAXCNVDXNC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |