C12H14N4O5S — CID 167818865
3-[(2,6-dimethoxyphenyl)sulfonylamino]-1H-pyrazole-5-carboxamide (PubChem CID 167818865) has the molecular formula C12H14N4O5S and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-[(2,6-dimethoxyphenyl)sulfonylamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2,6-dimethoxyphenyl)sulfonylamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167818865 |
| Molecular Formula | C12H14N4O5S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 3-[(2,6-dimethoxyphenyl)sulfonylamino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(OC)c1S(=O)(=O)Nc1cc(C(N)=O)[nH]n1 |
| InChI | InChI=1S/C12H14N4O5S/c1-20-8-4-3-5-9(21-2)11(8)22(18,19)16-10-6-7(12(13)17)14-15-10/h3-6H,1-2H3,(H2,13,17)(H2,14,15,16) |
| InChIKey | XHTQXLIKFAKEBN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |