C14H14F4N4O4S — CID 166435149
3-[[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]sulfonylamino]-1H-pyrazole-5-carboxamide (PubChem CID 166435149) has the molecular formula C14H14F4N4O4S and a molecular weight of 410.35 g/mol. Its IUPAC name is 3-[[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]sulfonylamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]sulfonylamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166435149 |
| Molecular Formula | C14H14F4N4O4S |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 3-[[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]sulfonylamino]-1H-pyrazole-5-carboxamide |
| SMILES | NC(=O)c1cc(NS(=O)(=O)c2cccc(COCC(F)(F)C(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C14H14F4N4O4S/c15-13(16)14(17,18)7-26-6-8-2-1-3-9(4-8)27(24,25)22-11-5-10(12(19)23)20-21-11/h1-5,13H,6-7H2,(H2,19,23)(H2,20,21,22) |
| InChIKey | UVVBQSUGXKIWII-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|